C10H12O3 — CID 131237107
(E,3R)-dec-8-en-4,6-diyne-1,3,10-triol (PubChem CID 131237107) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (E,3R)-dec-8-en-4,6-diyne-1,3,10-triol.
| Compound Name | (E,3R)-dec-8-en-4,6-diyne-1,3,10-triol |
|---|---|
| PubChem CID | 131237107 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (E,3R)-dec-8-en-4,6-diyne-1,3,10-triol |
| SMILES | OC/C=C/C#CC#C[C@H](O)CCO |
| InChI | InChI=1S/C10H12O3/c11-8-5-3-1-2-4-6-10(13)7-9-12/h3,5,10-13H,7-9H2/b5-3+/t10-/m0/s1 |
| InChIKey | PMUZCSDPAFASTR-GFAPAMAISA-N |
| XLogP | -0.71 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|