C10H12O4 — CID 163086034
dec-1-en-4,6-diyne-1,3,8,10-tetrol (PubChem CID 163086034) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is dec-1-en-4,6-diyne-1,3,8,10-tetrol.
| Compound Name | dec-1-en-4,6-diyne-1,3,8,10-tetrol |
|---|---|
| PubChem CID | 163086034 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | dec-1-en-4,6-diyne-1,3,8,10-tetrol |
| SMILES | OC=CC(O)C#CC#CC(O)CCO |
| InChI | InChI=1S/C10H12O4/c11-7-5-9(13)3-1-2-4-10(14)6-8-12/h5,7,9-14H,6,8H2 |
| InChIKey | CKUNPXPVCIRLJJ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|