About nona-5,7-diyn-4-ol
nona-5,7-diyn-4-ol (PubChem CID 13225481) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is nona-5,7-diyn-4-ol.
Molecular Properties
| Compound Name | nona-5,7-diyn-4-ol |
| PubChem CID | 13225481 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | nona-5,7-diyn-4-ol |
| SMILES | CC#CC#CC(O)CCC |
| InChI | InChI=1S/C9H12O/c1-3-5-6-8-9(10)7-4-2/h9-10H,4,7H2,1-2H3 |
| InChIKey | WSFGIYLNYANONT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze nona-5,7-diyn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nona-5,7-diyn-4-ol?
The IUPAC name of nona-5,7-diyn-4-ol (CID 13225481) is nona-5,7-diyn-4-ol.
What is the SMILES notation for nona-5,7-diyn-4-ol?
The canonical SMILES for nona-5,7-diyn-4-ol is CC#CC#CC(O)CCC.
What is the InChIKey of nona-5,7-diyn-4-ol?
The InChIKey is WSFGIYLNYANONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-3-5-6-8-9(10)7-4-2/h9-10H,4,7H2,1-2H3.
What are the key properties of nona-5,7-diyn-4-ol?
nona-5,7-diyn-4-ol has a molecular weight of 136.19 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nona-5,7-diyn-4-ol is sourced from PubChem (CID 13225481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).