About (3R)-hex-1-yn-3-ol
(3R)-hex-1-yn-3-ol (PubChem CID 6999992) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is (3R)-hex-1-yn-3-ol.
Molecular Properties
| Compound Name | (3R)-hex-1-yn-3-ol |
| PubChem CID | 6999992 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | (3R)-hex-1-yn-3-ol |
| SMILES | C#C[C@H](O)CCC |
| InChI | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3/t6-/m0/s1 |
| InChIKey | LTFTWJYRQNTCHI-LURJTMIESA-N |
| XLogP | 0.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-hex-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-hex-1-yn-3-ol?
The IUPAC name of (3R)-hex-1-yn-3-ol (CID 6999992) is (3R)-hex-1-yn-3-ol.
What is the SMILES notation for (3R)-hex-1-yn-3-ol?
The canonical SMILES for (3R)-hex-1-yn-3-ol is C#C[C@H](O)CCC.
What is the InChIKey of (3R)-hex-1-yn-3-ol?
The InChIKey is LTFTWJYRQNTCHI-LURJTMIESA-N. The full InChI is InChI=1S/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3/t6-/m0/s1.
What are the key properties of (3R)-hex-1-yn-3-ol?
(3R)-hex-1-yn-3-ol has a molecular weight of 98.14 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-hex-1-yn-3-ol is sourced from PubChem (CID 6999992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).