About butane-1,1-diol;oxotin
butane-1,1-diol;oxotin (PubChem CID 175410549) has the molecular formula C4H10O3Sn
and a molecular weight of 224.83 g/mol. Its IUPAC name is butane-1,1-diol;oxotin.
Molecular Properties
| Compound Name | butane-1,1-diol;oxotin |
| PubChem CID | 175410549 |
| Molecular Formula | C4H10O3Sn |
| Molecular Weight | 224.83 g/mol |
| Exact Mass | 225.97 |
| IUPAC Name | butane-1,1-diol;oxotin |
| SMILES | CCCC(O)O.O=[Sn] |
| InChI | InChI=1S/C4H10O2.O.Sn/c1-2-3-4(5)6;;/h4-6H,2-3H2,1H3;; |
| InChIKey | VGXUCRHACYYBDQ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.83 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butane-1,1-diol;oxotin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,1-diol;oxotin?
The IUPAC name of butane-1,1-diol;oxotin (CID 175410549) is butane-1,1-diol;oxotin.
What is the SMILES notation for butane-1,1-diol;oxotin?
The canonical SMILES for butane-1,1-diol;oxotin is CCCC(O)O.O=[Sn].
What is the InChIKey of butane-1,1-diol;oxotin?
The InChIKey is VGXUCRHACYYBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.O.Sn/c1-2-3-4(5)6;;/h4-6H,2-3H2,1H3;;.
What are the key properties of butane-1,1-diol;oxotin?
butane-1,1-diol;oxotin has a molecular weight of 224.83 g/mol, XLogP of -0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,1-diol;oxotin is sourced from PubChem (CID 175410549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).