C8H20O6 — CID 175408326
butane-1,1-diol;butane-1,2,3,4-tetrol (PubChem CID 175408326) has the molecular formula C8H20O6 and a molecular weight of 212.24 g/mol. Its IUPAC name is butane-1,1-diol;butane-1,2,3,4-tetrol.
| Compound Name | butane-1,1-diol;butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 175408326 |
| Molecular Formula | C8H20O6 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | butane-1,1-diol;butane-1,2,3,4-tetrol |
| SMILES | CCCC(O)O.OCC(O)C(O)CO |
| InChI | InChI=1S/C4H10O4.C4H10O2/c5-1-3(7)4(8)2-6;1-2-3-4(5)6/h3-8H,1-2H2;4-6H,2-3H2,1H3 |
| InChIKey | RTYPVYJFMFPLHM-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|