C5H12O3 — CID 11636797
(2S,3S)-pentane-1,2,3-triol (PubChem CID 11636797) has the molecular formula C5H12O3 and a molecular weight of 120.15 g/mol. Its IUPAC name is (2S,3S)-pentane-1,2,3-triol.
| Compound Name | (2S,3S)-pentane-1,2,3-triol |
|---|---|
| PubChem CID | 11636797 |
| Molecular Formula | C5H12O3 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | (2S,3S)-pentane-1,2,3-triol |
| SMILES | CC[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C5H12O3/c1-2-4(7)5(8)3-6/h4-8H,2-3H2,1H3/t4-,5-/m0/s1 |
| InChIKey | AALKGALVYCZETF-WHFBIAKZSA-N |
| XLogP | -0.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |