C8H20O4 — CID 155273073
butane;butane-1,2,3,4-tetrol (PubChem CID 155273073) has the molecular formula C8H20O4 and a molecular weight of 180.24 g/mol. Its IUPAC name is butane;butane-1,2,3,4-tetrol.
| Compound Name | butane;butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 155273073 |
| Molecular Formula | C8H20O4 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | butane;butane-1,2,3,4-tetrol |
| SMILES | CCCC.OCC(O)C(O)CO |
| InChI | InChI=1S/C4H10O4.C4H10/c5-1-3(7)4(8)2-6;1-3-4-2/h3-8H,1-2H2;3-4H2,1-2H3 |
| InChIKey | XCZVGXKRYSXSFT-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |