C9H22O4 — CID 87302258
ethoxyethane;pentane-1,2,3-triol (PubChem CID 87302258) has the molecular formula C9H22O4 and a molecular weight of 194.27 g/mol. Its IUPAC name is ethoxyethane;pentane-1,2,3-triol.
| Compound Name | ethoxyethane;pentane-1,2,3-triol |
|---|---|
| PubChem CID | 87302258 |
| Molecular Formula | C9H22O4 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | ethoxyethane;pentane-1,2,3-triol |
| SMILES | CCC(O)C(O)CO.CCOCC |
| InChI | InChI=1S/C5H12O3.C4H10O/c1-2-4(7)5(8)3-6;1-3-5-4-2/h4-8H,2-3H2,1H3;3-4H2,1-2H3 |
| InChIKey | YISJMNFFJDNKPD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |