C7H21O8P — CID 87153916
ethoxyethane;phosphoric acid;propane-1,2,3-triol (PubChem CID 87153916) has the molecular formula C7H21O8P and a molecular weight of 264.21 g/mol. Its IUPAC name is ethoxyethane;phosphoric acid;propane-1,2,3-triol.
| Compound Name | ethoxyethane;phosphoric acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 87153916 |
| Molecular Formula | C7H21O8P |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | ethoxyethane;phosphoric acid;propane-1,2,3-triol |
| SMILES | CCOCC.O=P(O)(O)O.OCC(O)CO |
| InChI | InChI=1S/C4H10O.C3H8O3.H3O4P/c1-3-5-4-2;4-1-3(6)2-5;1-5(2,3)4/h3-4H2,1-2H3;3-6H,1-2H2;(H3,1,2,3,4) |
| InChIKey | BDKOTYCPVXMJFR-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|