C10H24O4 — CID 19434693
ethoxyethane;hexane-1,2,6-triol (PubChem CID 19434693) has the molecular formula C10H24O4 and a molecular weight of 208.30 g/mol. Its IUPAC name is ethoxyethane;hexane-1,2,6-triol.
| Compound Name | ethoxyethane;hexane-1,2,6-triol |
|---|---|
| PubChem CID | 19434693 |
| Molecular Formula | C10H24O4 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | ethoxyethane;hexane-1,2,6-triol |
| SMILES | CCOCC.OCCCCC(O)CO |
| InChI | InChI=1S/C6H14O3.C4H10O/c7-4-2-1-3-6(9)5-8;1-3-5-4-2/h6-9H,1-5H2;3-4H2,1-2H3 |
| InChIKey | IXSYNRRBHYZYEO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|