C14H36O12S3 — CID 173057717
ethanesulfonic acid;octane-1,2,8-triol (PubChem CID 173057717) has the molecular formula C14H36O12S3 and a molecular weight of 492.63 g/mol. Its IUPAC name is ethanesulfonic acid;octane-1,2,8-triol.
| Compound Name | ethanesulfonic acid;octane-1,2,8-triol |
|---|---|
| PubChem CID | 173057717 |
| Molecular Formula | C14H36O12S3 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | ethanesulfonic acid;octane-1,2,8-triol |
| SMILES | CCS(=O)(=O)O.CCS(=O)(=O)O.CCS(=O)(=O)O.OCCCCCCC(O)CO |
| InChI | InChI=1S/C8H18O3.3C2H6O3S/c9-6-4-2-1-3-5-8(11)7-10;3*1-2-6(3,4)5/h8-11H,1-7H2;3*2H2,1H3,(H,3,4,5) |
| InChIKey | HROPQEJQFYTKNB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|