C11H28O6 — CID 87275832
butane-1,1-diol;ethoxyethane;propane-1,2,3-triol (PubChem CID 87275832) has the molecular formula C11H28O6 and a molecular weight of 256.34 g/mol. Its IUPAC name is butane-1,1-diol;ethoxyethane;propane-1,2,3-triol.
| Compound Name | butane-1,1-diol;ethoxyethane;propane-1,2,3-triol |
|---|---|
| PubChem CID | 87275832 |
| Molecular Formula | C11H28O6 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | butane-1,1-diol;ethoxyethane;propane-1,2,3-triol |
| SMILES | CCCC(O)O.CCOCC.OCC(O)CO |
| InChI | InChI=1S/C4H10O2.C4H10O.C3H8O3/c1-2-3-4(5)6;1-3-5-4-2;4-1-3(6)2-5/h4-6H,2-3H2,1H3;3-4H2,1-2H3;3-6H,1-2H2 |
| InChIKey | WNRYHMUGHXWJFP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|