About ethoxyethane;(2S)-pentan-2-ol
ethoxyethane;(2S)-pentan-2-ol (PubChem CID 157362053) has the molecular formula C9H22O2
and a molecular weight of 162.27 g/mol. Its IUPAC name is ethoxyethane;(2S)-pentan-2-ol.
Molecular Properties
| Compound Name | ethoxyethane;(2S)-pentan-2-ol |
| PubChem CID | 157362053 |
| Molecular Formula | C9H22O2 |
| Molecular Weight | 162.27 g/mol |
| Exact Mass | 162.16 |
| IUPAC Name | ethoxyethane;(2S)-pentan-2-ol |
| SMILES | CCC[C@H](C)O.CCOCC |
| InChI | InChI=1S/C5H12O.C4H10O/c1-3-4-5(2)6;1-3-5-4-2/h5-6H,3-4H2,1-2H3;3-4H2,1-2H3/t5-;/m0./s1 |
| InChIKey | BITGNZBJNNWTGD-JEDNCBNOSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethoxyethane;(2S)-pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;(2S)-pentan-2-ol?
The IUPAC name of ethoxyethane;(2S)-pentan-2-ol (CID 157362053) is ethoxyethane;(2S)-pentan-2-ol.
What is the SMILES notation for ethoxyethane;(2S)-pentan-2-ol?
The canonical SMILES for ethoxyethane;(2S)-pentan-2-ol is CCC[C@H](C)O.CCOCC.
What is the InChIKey of ethoxyethane;(2S)-pentan-2-ol?
The InChIKey is BITGNZBJNNWTGD-JEDNCBNOSA-N. The full InChI is InChI=1S/C5H12O.C4H10O/c1-3-4-5(2)6;1-3-5-4-2/h5-6H,3-4H2,1-2H3;3-4H2,1-2H3/t5-;/m0./s1.
What are the key properties of ethoxyethane;(2S)-pentan-2-ol?
ethoxyethane;(2S)-pentan-2-ol has a molecular weight of 162.27 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;(2S)-pentan-2-ol is sourced from PubChem (CID 157362053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).