About hexan-2-ol;pentan-2-ol
hexan-2-ol;pentan-2-ol (PubChem CID 88680973) has the molecular formula C11H26O2
and a molecular weight of 190.33 g/mol. Its IUPAC name is hexan-2-ol;pentan-2-ol.
Molecular Properties
| Compound Name | hexan-2-ol;pentan-2-ol |
| PubChem CID | 88680973 |
| Molecular Formula | C11H26O2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.19 |
| IUPAC Name | hexan-2-ol;pentan-2-ol |
| SMILES | CCCC(C)O.CCCCC(C)O |
| InChI | InChI=1S/C6H14O.C5H12O/c1-3-4-5-6(2)7;1-3-4-5(2)6/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | QHYIOWKKFZDSTP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hexan-2-ol;pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-ol;pentan-2-ol?
The IUPAC name of hexan-2-ol;pentan-2-ol (CID 88680973) is hexan-2-ol;pentan-2-ol.
What is the SMILES notation for hexan-2-ol;pentan-2-ol?
The canonical SMILES for hexan-2-ol;pentan-2-ol is CCCC(C)O.CCCCC(C)O.
What is the InChIKey of hexan-2-ol;pentan-2-ol?
The InChIKey is QHYIOWKKFZDSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C5H12O/c1-3-4-5-6(2)7;1-3-4-5(2)6/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of hexan-2-ol;pentan-2-ol?
hexan-2-ol;pentan-2-ol has a molecular weight of 190.33 g/mol, XLogP of 2.72, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-ol;pentan-2-ol is sourced from PubChem (CID 88680973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).