About benzene;hexan-2-ol
benzene;hexan-2-ol (PubChem CID 174579547) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is benzene;hexan-2-ol.
Molecular Properties
| Compound Name | benzene;hexan-2-ol |
| PubChem CID | 174579547 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | benzene;hexan-2-ol |
| SMILES | CCCCC(C)O.c1ccccc1 |
| InChI | InChI=1S/C6H14O.C6H6/c1-3-4-5-6(2)7;1-2-4-6-5-3-1/h6-7H,3-5H2,1-2H3;1-6H |
| InChIKey | RUWBGQOUZWLNOD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;hexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;hexan-2-ol?
The IUPAC name of benzene;hexan-2-ol (CID 174579547) is benzene;hexan-2-ol.
What is the SMILES notation for benzene;hexan-2-ol?
The canonical SMILES for benzene;hexan-2-ol is CCCCC(C)O.c1ccccc1.
What is the InChIKey of benzene;hexan-2-ol?
The InChIKey is RUWBGQOUZWLNOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C6H6/c1-3-4-5-6(2)7;1-2-4-6-5-3-1/h6-7H,3-5H2,1-2H3;1-6H.
What are the key properties of benzene;hexan-2-ol?
benzene;hexan-2-ol has a molecular weight of 180.29 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;hexan-2-ol is sourced from PubChem (CID 174579547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).