C8H20O2 — CID 87427051
butane;butane-1,1-diol (PubChem CID 87427051) has the molecular formula C8H20O2 and a molecular weight of 148.25 g/mol. Its IUPAC name is butane;butane-1,1-diol.
| Compound Name | butane;butane-1,1-diol |
|---|---|
| PubChem CID | 87427051 |
| Molecular Formula | C8H20O2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.15 |
| IUPAC Name | butane;butane-1,1-diol |
| SMILES | CCCC.CCCC(O)O |
| InChI | InChI=1S/C4H10O2.C4H10/c1-2-3-4(5)6;1-3-4-2/h4-6H,2-3H2,1H3;3-4H2,1-2H3 |
| InChIKey | QGCZWFQNEUYXND-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|