About CID 175979534
CID 175979534 (PubChem CID 175979534) has the molecular formula C4H14Cl4O14
and a molecular weight of 427.95 g/mol.
Molecular Properties
| Compound Name | CID 175979534 |
| PubChem CID | 175979534 |
| Molecular Formula | C4H14Cl4O14 |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | — |
| SMILES | CCCC(O)O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O |
| InChI | InChI=1S/C4H10O2.4ClHO3/c1-2-3-4(5)6;4*2-1(3)4/h4-6H,2-3H2,1H3;4*2H |
| InChIKey | BGFOGIFOLQETQP-UHFFFAOYSA-N |
| XLogP | -11.64 |
| TPSA | 305.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | -11.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 175979534 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175979534?
The IUPAC name of CID 175979534 (CID 175979534) is not available.
What is the SMILES notation for CID 175979534?
The canonical SMILES for CID 175979534 is CCCC(O)O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.[O-][Cl+2]([O-])O.
What is the InChIKey of CID 175979534?
The InChIKey is BGFOGIFOLQETQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.4ClHO3/c1-2-3-4(5)6;4*2-1(3)4/h4-6H,2-3H2,1H3;4*2H.
What are the key properties of CID 175979534?
CID 175979534 has a molecular weight of 427.95 g/mol, XLogP of -11.64, 2 rotatable bonds, 6 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175979534 is sourced from PubChem (CID 175979534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).