C12H28O3 — CID 174889457
butane-1,1-diol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (PubChem CID 174889457) has the molecular formula C12H28O3 and a molecular weight of 220.35 g/mol. Its IUPAC name is butane-1,1-diol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
| Compound Name | butane-1,1-diol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
|---|---|
| PubChem CID | 174889457 |
| Molecular Formula | C12H28O3 |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.20 |
| IUPAC Name | butane-1,1-diol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| SMILES | CC(C)(C)OC(C)(C)C.CCCC(O)O |
| InChI | InChI=1S/C8H18O.C4H10O2/c1-7(2,3)9-8(4,5)6;1-2-3-4(5)6/h1-6H3;4-6H,2-3H2,1H3 |
| InChIKey | YXXKOGBJTNNXEI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|