C10H22O8 — CID 158734382
bis(butane-1,1-diol);oxalic acid (PubChem CID 158734382) has the molecular formula C10H22O8 and a molecular weight of 270.28 g/mol. Its IUPAC name is bis(butane-1,1-diol);oxalic acid.
| Compound Name | bis(butane-1,1-diol);oxalic acid |
|---|---|
| PubChem CID | 158734382 |
| Molecular Formula | C10H22O8 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | bis(butane-1,1-diol);oxalic acid |
| SMILES | CCCC(O)O.CCCC(O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/2C4H10O2.C2H2O4/c2*1-2-3-4(5)6;3-1(4)2(5)6/h2*4-6H,2-3H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | SXIGJMAPILHIET-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|