C14H30O6S2 — CID 174211945
butane-1,1-diol;bis(3-methyl-3-sulfanylbutanoic acid) (PubChem CID 174211945) has the molecular formula C14H30O6S2 and a molecular weight of 358.52 g/mol. Its IUPAC name is butane-1,1-diol;bis(3-methyl-3-sulfanylbutanoic acid).
| Compound Name | butane-1,1-diol;bis(3-methyl-3-sulfanylbutanoic acid) |
|---|---|
| PubChem CID | 174211945 |
| Molecular Formula | C14H30O6S2 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | butane-1,1-diol;bis(3-methyl-3-sulfanylbutanoic acid) |
| SMILES | CC(C)(S)CC(=O)O.CC(C)(S)CC(=O)O.CCCC(O)O |
| InChI | InChI=1S/2C5H10O2S.C4H10O2/c2*1-5(2,8)3-4(6)7;1-2-3-4(5)6/h2*8H,3H2,1-2H3,(H,6,7);4-6H,2-3H2,1H3 |
| InChIKey | KMFJFPQWCBKNTP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|