C5H12O5 — CID 88634618
butane-1,1-diol;carbonic acid (PubChem CID 88634618) has the molecular formula C5H12O5 and a molecular weight of 152.15 g/mol. Its IUPAC name is butane-1,1-diol;carbonic acid.
| Compound Name | butane-1,1-diol;carbonic acid |
|---|---|
| PubChem CID | 88634618 |
| Molecular Formula | C5H12O5 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | butane-1,1-diol;carbonic acid |
| SMILES | CCCC(O)O.O=C(O)O |
| InChI | InChI=1S/C4H10O2.CH2O3/c1-2-3-4(5)6;2-1(3)4/h4-6H,2-3H2,1H3;(H2,2,3,4) |
| InChIKey | UOSMUCBDKZXJBL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|