C12H26O6S2 — CID 87142167
butane-1,1-diol;bis(2-methyl-3-sulfanylpropanoic acid) (PubChem CID 87142167) has the molecular formula C12H26O6S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is butane-1,1-diol;bis(2-methyl-3-sulfanylpropanoic acid).
| Compound Name | butane-1,1-diol;bis(2-methyl-3-sulfanylpropanoic acid) |
|---|---|
| PubChem CID | 87142167 |
| Molecular Formula | C12H26O6S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | butane-1,1-diol;bis(2-methyl-3-sulfanylpropanoic acid) |
| SMILES | CC(CS)C(=O)O.CC(CS)C(=O)O.CCCC(O)O |
| InChI | InChI=1S/2C4H8O2S.C4H10O2/c2*1-3(2-7)4(5)6;1-2-3-4(5)6/h2*3,7H,2H2,1H3,(H,5,6);4-6H,2-3H2,1H3 |
| InChIKey | CRCWRCVJFDOMNN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|