C9H20O6S — CID 159577471
2,2-bis(hydroxymethyl)propane-1,3-diol;2-methyl-3-sulfanylpropanoic acid (PubChem CID 159577471) has the molecular formula C9H20O6S and a molecular weight of 256.32 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2-methyl-3-sulfanylpropanoic acid.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2-methyl-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 159577471 |
| Molecular Formula | C9H20O6S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2-methyl-3-sulfanylpropanoic acid |
| SMILES | CC(CS)C(=O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C4H8O2S/c6-1-5(2-7,3-8)4-9;1-3(2-7)4(5)6/h6-9H,1-4H2;3,7H,2H2,1H3,(H,5,6) |
| InChIKey | MIOXZDNOJXSUEV-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|