C8H19NO6S — CID 157271832
(2S)-2-amino-3-sulfanylpropanoic acid;2,2-bis(hydroxymethyl)propane-1,3-diol (PubChem CID 157271832) has the molecular formula C8H19NO6S and a molecular weight of 257.31 g/mol. Its IUPAC name is (2S)-2-amino-3-sulfanylpropanoic acid;2,2-bis(hydroxymethyl)propane-1,3-diol.
| Compound Name | (2S)-2-amino-3-sulfanylpropanoic acid;2,2-bis(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 157271832 |
| Molecular Formula | C8H19NO6S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2S)-2-amino-3-sulfanylpropanoic acid;2,2-bis(hydroxymethyl)propane-1,3-diol |
| SMILES | N[C@H](CS)C(=O)O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C3H7NO2S/c6-1-5(2-7,3-8)4-9;4-2(1-7)3(5)6/h6-9H,1-4H2;2,7H,1,4H2,(H,5,6)/t;2-/m.1/s1 |
| InChIKey | AYQAMVOXANOTDG-ARGLLVQISA-N |
| XLogP | -2.73 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|