C7H13HgO4 — CID 174882415
butane-1,1-diol;mercury(1+);prop-2-enoate (PubChem CID 174882415) has the molecular formula C7H13HgO4 and a molecular weight of 361.77 g/mol. Its IUPAC name is butane-1,1-diol;mercury(1+);prop-2-enoate.
| Compound Name | butane-1,1-diol;mercury(1+);prop-2-enoate |
|---|---|
| PubChem CID | 174882415 |
| Molecular Formula | C7H13HgO4 |
| Molecular Weight | 361.77 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | butane-1,1-diol;mercury(1+);prop-2-enoate |
| SMILES | C=CC(=O)[O-].CCCC(O)O.[Hg+] |
| InChI | InChI=1S/C4H10O2.C3H4O2.Hg/c1-2-3-4(5)6;1-2-3(4)5;/h4-6H,2-3H2,1H3;2H,1H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | XZUGSHPXIDUXSE-UHFFFAOYSA-M |
| XLogP | -0.98 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.77 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|