C21H38O8 — CID 157166263
dodecane-1,1-diol;tris(prop-2-enoic acid) (PubChem CID 157166263) has the molecular formula C21H38O8 and a molecular weight of 418.53 g/mol. Its IUPAC name is dodecane-1,1-diol;tris(prop-2-enoic acid).
| Compound Name | dodecane-1,1-diol;tris(prop-2-enoic acid) |
|---|---|
| PubChem CID | 157166263 |
| Molecular Formula | C21H38O8 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | dodecane-1,1-diol;tris(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.CCCCCCCCCCCC(O)O |
| InChI | InChI=1S/C12H26O2.3C3H4O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;3*1-2-3(4)5/h12-14H,2-11H2,1H3;3*2H,1H2,(H,4,5) |
| InChIKey | AMYGUAIELHFJTN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|