About dodecane-1,1-diol;dihydrochloride
dodecane-1,1-diol;dihydrochloride (PubChem CID 87128887) has the molecular formula C12H28Cl2O2
and a molecular weight of 275.26 g/mol. Its IUPAC name is dodecane-1,1-diol;dihydrochloride.
Molecular Properties
| Compound Name | dodecane-1,1-diol;dihydrochloride |
| PubChem CID | 87128887 |
| Molecular Formula | C12H28Cl2O2 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | dodecane-1,1-diol;dihydrochloride |
| SMILES | CCCCCCCCCCCC(O)O.Cl.Cl |
| InChI | InChI=1S/C12H26O2.2ClH/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;;/h12-14H,2-11H2,1H3;2*1H |
| InChIKey | VQGXAZQXZQTSHR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dodecane-1,1-diol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecane-1,1-diol;dihydrochloride?
The IUPAC name of dodecane-1,1-diol;dihydrochloride (CID 87128887) is dodecane-1,1-diol;dihydrochloride.
What is the SMILES notation for dodecane-1,1-diol;dihydrochloride?
The canonical SMILES for dodecane-1,1-diol;dihydrochloride is CCCCCCCCCCCC(O)O.Cl.Cl.
What is the InChIKey of dodecane-1,1-diol;dihydrochloride?
The InChIKey is VQGXAZQXZQTSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2.2ClH/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;;/h12-14H,2-11H2,1H3;2*1H.
What are the key properties of dodecane-1,1-diol;dihydrochloride?
dodecane-1,1-diol;dihydrochloride has a molecular weight of 275.26 g/mol, XLogP of 4.06, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecane-1,1-diol;dihydrochloride is sourced from PubChem (CID 87128887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).