About 4-aminohenicosane-1,1-diol;hydrochloride
4-aminohenicosane-1,1-diol;hydrochloride (PubChem CID 173150199) has the molecular formula C21H46ClNO2
and a molecular weight of 380.06 g/mol. Its IUPAC name is 4-aminohenicosane-1,1-diol;hydrochloride.
Molecular Properties
| Compound Name | 4-aminohenicosane-1,1-diol;hydrochloride |
| PubChem CID | 173150199 |
| Molecular Formula | C21H46ClNO2 |
| Molecular Weight | 380.06 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | 4-aminohenicosane-1,1-diol;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCCC(N)CCC(O)O.Cl |
| InChI | InChI=1S/C21H45NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)18-19-21(23)24;/h20-21,23-24H,2-19,22H2,1H3;1H |
| InChIKey | GFDFLVCHLGICSB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.06 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-aminohenicosane-1,1-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminohenicosane-1,1-diol;hydrochloride?
The IUPAC name of 4-aminohenicosane-1,1-diol;hydrochloride (CID 173150199) is 4-aminohenicosane-1,1-diol;hydrochloride.
What is the SMILES notation for 4-aminohenicosane-1,1-diol;hydrochloride?
The canonical SMILES for 4-aminohenicosane-1,1-diol;hydrochloride is CCCCCCCCCCCCCCCCCC(N)CCC(O)O.Cl.
What is the InChIKey of 4-aminohenicosane-1,1-diol;hydrochloride?
The InChIKey is GFDFLVCHLGICSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)18-19-21(23)24;/h20-21,23-24H,2-19,22H2,1H3;1H.
What are the key properties of 4-aminohenicosane-1,1-diol;hydrochloride?
4-aminohenicosane-1,1-diol;hydrochloride has a molecular weight of 380.06 g/mol, XLogP of 6.09, 19 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminohenicosane-1,1-diol;hydrochloride is sourced from PubChem (CID 173150199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).