About decane;dodecane-1,1-diol
decane;dodecane-1,1-diol (PubChem CID 162011285) has the molecular formula C22H48O2
and a molecular weight of 344.62 g/mol. Its IUPAC name is decane;dodecane-1,1-diol.
Molecular Properties
| Compound Name | decane;dodecane-1,1-diol |
| PubChem CID | 162011285 |
| Molecular Formula | C22H48O2 |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.37 |
| IUPAC Name | decane;dodecane-1,1-diol |
| SMILES | CCCCCCCCCC.CCCCCCCCCCCC(O)O |
| InChI | InChI=1S/C12H26O2.C10H22/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-3-5-7-9-10-8-6-4-2/h12-14H,2-11H2,1H3;3-10H2,1-2H3 |
| InChIKey | YTMWVTHFNVGFJO-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze decane;dodecane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane;dodecane-1,1-diol?
The IUPAC name of decane;dodecane-1,1-diol (CID 162011285) is decane;dodecane-1,1-diol.
What is the SMILES notation for decane;dodecane-1,1-diol?
The canonical SMILES for decane;dodecane-1,1-diol is CCCCCCCCCC.CCCCCCCCCCCC(O)O.
What is the InChIKey of decane;dodecane-1,1-diol?
The InChIKey is YTMWVTHFNVGFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2.C10H22/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-3-5-7-9-10-8-6-4-2/h12-14H,2-11H2,1H3;3-10H2,1-2H3.
What are the key properties of decane;dodecane-1,1-diol?
decane;dodecane-1,1-diol has a molecular weight of 344.62 g/mol, XLogP of 7.36, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decane;dodecane-1,1-diol is sourced from PubChem (CID 162011285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).