About bis(octane);octane-1,1-diol;titanium(3+)
bis(octane);octane-1,1-diol;titanium(3+) (PubChem CID 87212095) has the molecular formula C24H51O2Ti
and a molecular weight of 419.54 g/mol. Its IUPAC name is bis(octane);octane-1,1-diol;titanium(3+).
Molecular Properties
| Compound Name | bis(octane);octane-1,1-diol;titanium(3+) |
| PubChem CID | 87212095 |
| Molecular Formula | C24H51O2Ti |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.34 |
| IUPAC Name | bis(octane);octane-1,1-diol;titanium(3+) |
| SMILES | [CH2-]CCCCCCC.[CH2-]CCCCCCC.[CH2-]CCCCCCC(O)O.[Ti+3] |
| InChI | InChI=1S/C8H17O2.2C8H17.Ti/c1-2-3-4-5-6-7-8(9)10;2*1-3-5-7-8-6-4-2;/h8-10H,1-7H2;2*1,3-8H2,2H3;/q3*-1;+3 |
| InChIKey | MOSMFBUUVFUESJ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(octane);octane-1,1-diol;titanium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(octane);octane-1,1-diol;titanium(3+)?
The IUPAC name of bis(octane);octane-1,1-diol;titanium(3+) (CID 87212095) is bis(octane);octane-1,1-diol;titanium(3+).
What is the SMILES notation for bis(octane);octane-1,1-diol;titanium(3+)?
The canonical SMILES for bis(octane);octane-1,1-diol;titanium(3+) is [CH2-]CCCCCCC.[CH2-]CCCCCCC.[CH2-]CCCCCCC(O)O.[Ti+3].
What is the InChIKey of bis(octane);octane-1,1-diol;titanium(3+)?
The InChIKey is MOSMFBUUVFUESJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O2.2C8H17.Ti/c1-2-3-4-5-6-7-8(9)10;2*1-3-5-7-8-6-4-2;/h8-10H,1-7H2;2*1,3-8H2,2H3;/q3*-1;+3.
What are the key properties of bis(octane);octane-1,1-diol;titanium(3+)?
bis(octane);octane-1,1-diol;titanium(3+) has a molecular weight of 419.54 g/mol, XLogP of 7.83, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(octane);octane-1,1-diol;titanium(3+) is sourced from PubChem (CID 87212095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).