About methoxymethane;tridecane-1,1-diol
methoxymethane;tridecane-1,1-diol (PubChem CID 18004105) has the molecular formula C15H34O3
and a molecular weight of 262.43 g/mol. Its IUPAC name is methoxymethane;tridecane-1,1-diol.
Molecular Properties
| Compound Name | methoxymethane;tridecane-1,1-diol |
| PubChem CID | 18004105 |
| Molecular Formula | C15H34O3 |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | methoxymethane;tridecane-1,1-diol |
| SMILES | CCCCCCCCCCCCC(O)O.COC |
| InChI | InChI=1S/C13H28O2.C2H6O/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15;1-3-2/h13-15H,2-12H2,1H3;1-2H3 |
| InChIKey | UJSSCURJAHRCLI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;tridecane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;tridecane-1,1-diol?
The IUPAC name of methoxymethane;tridecane-1,1-diol (CID 18004105) is methoxymethane;tridecane-1,1-diol.
What is the SMILES notation for methoxymethane;tridecane-1,1-diol?
The canonical SMILES for methoxymethane;tridecane-1,1-diol is CCCCCCCCCCCCC(O)O.COC.
What is the InChIKey of methoxymethane;tridecane-1,1-diol?
The InChIKey is UJSSCURJAHRCLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2.C2H6O/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15;1-3-2/h13-15H,2-12H2,1H3;1-2H3.
What are the key properties of methoxymethane;tridecane-1,1-diol?
methoxymethane;tridecane-1,1-diol has a molecular weight of 262.43 g/mol, XLogP of 3.87, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;tridecane-1,1-diol is sourced from PubChem (CID 18004105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).