C27H52O6 — CID 175364016
bis(2-methylprop-2-enoic acid);nonadecane-1,1-diol (PubChem CID 175364016) has the molecular formula C27H52O6 and a molecular weight of 472.71 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);nonadecane-1,1-diol.
| Compound Name | bis(2-methylprop-2-enoic acid);nonadecane-1,1-diol |
|---|---|
| PubChem CID | 175364016 |
| Molecular Formula | C27H52O6 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.38 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);nonadecane-1,1-diol |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CCCCCCCCCCCCCCCCCCC(O)O |
| InChI | InChI=1S/C19H40O2.2C4H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21;2*1-3(2)4(5)6/h19-21H,2-18H2,1H3;2*1H2,2H3,(H,5,6) |
| InChIKey | PIVGDLGWXAKAGX-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|