About 2-methylprop-2-enoic acid;octan-2-ol
2-methylprop-2-enoic acid;octan-2-ol (PubChem CID 174649051) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;octan-2-ol.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;octan-2-ol |
| PubChem CID | 174649051 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2-methylprop-2-enoic acid;octan-2-ol |
| SMILES | C=C(C)C(=O)O.CCCCCCC(C)O |
| InChI | InChI=1S/C8H18O.C4H6O2/c1-3-4-5-6-7-8(2)9;1-3(2)4(5)6/h8-9H,3-7H2,1-2H3;1H2,2H3,(H,5,6) |
| InChIKey | BYJBUTZLGJDRIZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;octan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;octan-2-ol?
The IUPAC name of 2-methylprop-2-enoic acid;octan-2-ol (CID 174649051) is 2-methylprop-2-enoic acid;octan-2-ol.
What is the SMILES notation for 2-methylprop-2-enoic acid;octan-2-ol?
The canonical SMILES for 2-methylprop-2-enoic acid;octan-2-ol is C=C(C)C(=O)O.CCCCCCC(C)O.
What is the InChIKey of 2-methylprop-2-enoic acid;octan-2-ol?
The InChIKey is BYJBUTZLGJDRIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C4H6O2/c1-3-4-5-6-7-8(2)9;1-3(2)4(5)6/h8-9H,3-7H2,1-2H3;1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;octan-2-ol?
2-methylprop-2-enoic acid;octan-2-ol has a molecular weight of 216.32 g/mol, XLogP of 2.98, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;octan-2-ol is sourced from PubChem (CID 174649051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).