C16H32O8 — CID 173263154
ethane-1,2-diol;hexane-1,1-diol;bis(2-methylprop-2-enoic acid) (PubChem CID 173263154) has the molecular formula C16H32O8 and a molecular weight of 352.42 g/mol. Its IUPAC name is ethane-1,2-diol;hexane-1,1-diol;bis(2-methylprop-2-enoic acid).
| Compound Name | ethane-1,2-diol;hexane-1,1-diol;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 173263154 |
| Molecular Formula | C16H32O8 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | ethane-1,2-diol;hexane-1,1-diol;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CCCCCC(O)O.OCCO |
| InChI | InChI=1S/C6H14O2.2C4H6O2.C2H6O2/c1-2-3-4-5-6(7)8;2*1-3(2)4(5)6;3-1-2-4/h6-8H,2-5H2,1H3;2*1H2,2H3,(H,5,6);3-4H,1-2H2 |
| InChIKey | GRIJWXSWUFSLHZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|