C14H26O8 — CID 87268743
hexane-1,1-diol;bis(3-oxobutanoic acid) (PubChem CID 87268743) has the molecular formula C14H26O8 and a molecular weight of 322.35 g/mol. Its IUPAC name is hexane-1,1-diol;bis(3-oxobutanoic acid).
| Compound Name | hexane-1,1-diol;bis(3-oxobutanoic acid) |
|---|---|
| PubChem CID | 87268743 |
| Molecular Formula | C14H26O8 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | hexane-1,1-diol;bis(3-oxobutanoic acid) |
| SMILES | CC(=O)CC(=O)O.CC(=O)CC(=O)O.CCCCCC(O)O |
| InChI | InChI=1S/C6H14O2.2C4H6O3/c1-2-3-4-5-6(7)8;2*1-3(5)2-4(6)7/h6-8H,2-5H2,1H3;2*2H2,1H3,(H,6,7) |
| InChIKey | VBFUNYNWQPBRKR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|