C10H18O6 — CID 175282751
2-methylidenebutanedioic acid;pentane-1,1-diol (PubChem CID 175282751) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-methylidenebutanedioic acid;pentane-1,1-diol.
| Compound Name | 2-methylidenebutanedioic acid;pentane-1,1-diol |
|---|---|
| PubChem CID | 175282751 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-methylidenebutanedioic acid;pentane-1,1-diol |
| SMILES | C=C(CC(=O)O)C(=O)O.CCCCC(O)O |
| InChI | InChI=1S/C5H6O4.C5H12O2/c1-3(5(8)9)2-4(6)7;1-2-3-4-5(6)7/h1-2H2,(H,6,7)(H,8,9);5-7H,2-4H2,1H3 |
| InChIKey | OVGUUUUJJQBISE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|