C5H13NaO3 — CID 173234204
sodium;3-ethoxypropane-1,2-diol;hydride (PubChem CID 173234204) has the molecular formula C5H13NaO3 and a molecular weight of 144.15 g/mol. Its IUPAC name is sodium;3-ethoxypropane-1,2-diol;hydride.
| Compound Name | sodium;3-ethoxypropane-1,2-diol;hydride |
|---|---|
| PubChem CID | 173234204 |
| Molecular Formula | C5H13NaO3 |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | sodium;3-ethoxypropane-1,2-diol;hydride |
| SMILES | CCOCC(O)CO.[H-].[Na+] |
| InChI | InChI=1S/C5H12O3.Na.H/c1-2-8-4-5(7)3-6;;/h5-7H,2-4H2,1H3;;/q;+1;-1 |
| InChIKey | HCIXWBYMMHCEAJ-UHFFFAOYSA-N |
| XLogP | -3.51 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |