C9H20O5 — CID 57186683
3-[2-(2-ethoxyethoxy)ethoxy]propane-1,2-diol (PubChem CID 57186683) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is 3-[2-(2-ethoxyethoxy)ethoxy]propane-1,2-diol.
| Compound Name | 3-[2-(2-ethoxyethoxy)ethoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 57186683 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3-[2-(2-ethoxyethoxy)ethoxy]propane-1,2-diol |
| SMILES | CCOCCOCCOCC(O)CO |
| InChI | InChI=1S/C9H20O5/c1-2-12-3-4-13-5-6-14-8-9(11)7-10/h9-11H,2-8H2,1H3 |
| InChIKey | AMRBOLAOBWGZGZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|