C6H14Cl2MgO5 — CID 174372262
magnesium;3-(2,3-dihydroxypropoxy)propane-1,2-diol;dichloride (PubChem CID 174372262) has the molecular formula C6H14Cl2MgO5 and a molecular weight of 261.38 g/mol. Its IUPAC name is magnesium;3-(2,3-dihydroxypropoxy)propane-1,2-diol;dichloride.
| Compound Name | magnesium;3-(2,3-dihydroxypropoxy)propane-1,2-diol;dichloride |
|---|---|
| PubChem CID | 174372262 |
| Molecular Formula | C6H14Cl2MgO5 |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | magnesium;3-(2,3-dihydroxypropoxy)propane-1,2-diol;dichloride |
| SMILES | OCC(O)COCC(O)CO.[Cl-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C6H14O5.2ClH.Mg/c7-1-5(9)3-11-4-6(10)2-8;;;/h5-10H,1-4H2;2*1H;/q;;;+2/p-2 |
| InChIKey | FTFBLHFGDHNNCC-UHFFFAOYSA-L |
| XLogP | -8.66 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | -8.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |