C5H13NO4 — CID 87602858
3-(2-amino-2-hydroxyethoxy)propane-1,2-diol (PubChem CID 87602858) has the molecular formula C5H13NO4 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3-(2-amino-2-hydroxyethoxy)propane-1,2-diol.
| Compound Name | 3-(2-amino-2-hydroxyethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 87602858 |
| Molecular Formula | C5H13NO4 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 3-(2-amino-2-hydroxyethoxy)propane-1,2-diol |
| SMILES | NC(O)COCC(O)CO |
| InChI | InChI=1S/C5H13NO4/c6-5(9)3-10-2-4(8)1-7/h4-5,7-9H,1-3,6H2 |
| InChIKey | CDEKZWZPFZLQJF-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|