C7H16O7 — CID 174848514
3-(2,3-dihydroxypropoxy)propane-1,2-diol;formic acid (PubChem CID 174848514) has the molecular formula C7H16O7 and a molecular weight of 212.20 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxy)propane-1,2-diol;formic acid.
| Compound Name | 3-(2,3-dihydroxypropoxy)propane-1,2-diol;formic acid |
|---|---|
| PubChem CID | 174848514 |
| Molecular Formula | C7H16O7 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3-(2,3-dihydroxypropoxy)propane-1,2-diol;formic acid |
| SMILES | O=CO.OCC(O)COCC(O)CO |
| InChI | InChI=1S/C6H14O5.CH2O2/c7-1-5(9)3-11-4-6(10)2-8;2-1-3/h5-10H,1-4H2;1H,(H,2,3) |
| InChIKey | UFDZLPQBEPPOKW-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|