C6H10O6 — CID 87900823
formyl 2-(2,3-dihydroxypropoxy)acetate (PubChem CID 87900823) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is formyl 2-(2,3-dihydroxypropoxy)acetate.
| Compound Name | formyl 2-(2,3-dihydroxypropoxy)acetate |
|---|---|
| PubChem CID | 87900823 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | formyl 2-(2,3-dihydroxypropoxy)acetate |
| SMILES | O=COC(=O)COCC(O)CO |
| InChI | InChI=1S/C6H10O6/c7-1-5(9)2-11-3-6(10)12-4-8/h4-5,7,9H,1-3H2 |
| InChIKey | AGCLFVCEVOPYOJ-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|