C12H18I4O6 — CID 85076926
3-[6-(2,3-dihydroxypropoxy)-2,3,4,5-tetraiodohexa-2,4-dienoxy]propane-1,2-diol (PubChem CID 85076926) has the molecular formula C12H18I4O6 and a molecular weight of 765.89 g/mol. Its IUPAC name is 3-[6-(2,3-dihydroxypropoxy)-2,3,4,5-tetraiodohexa-2,4-dienoxy]propane-1,2-diol.
| Compound Name | 3-[6-(2,3-dihydroxypropoxy)-2,3,4,5-tetraiodohexa-2,4-dienoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 85076926 |
| Molecular Formula | C12H18I4O6 |
| Molecular Weight | 765.89 g/mol |
| Exact Mass | 765.73 |
| IUPAC Name | 3-[6-(2,3-dihydroxypropoxy)-2,3,4,5-tetraiodohexa-2,4-dienoxy]propane-1,2-diol |
| SMILES | OCC(O)COCC(I)=C(I)C(I)=C(I)COCC(O)CO |
| InChI | InChI=1S/C12H18I4O6/c13-9(5-21-3-7(19)1-17)11(15)12(16)10(14)6-22-4-8(20)2-18/h7-8,17-20H,1-6H2 |
| InChIKey | BRZVOWLFZVNHKL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.89 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|