C3H7BrO3 — CID 23618335
2,3-dihydroxypropyl hypobromite (PubChem CID 23618335) has the molecular formula C3H7BrO3 and a molecular weight of 170.99 g/mol. Its IUPAC name is 2,3-dihydroxypropyl hypobromite.
| Compound Name | 2,3-dihydroxypropyl hypobromite |
|---|---|
| PubChem CID | 23618335 |
| Molecular Formula | C3H7BrO3 |
| Molecular Weight | 170.99 g/mol |
| Exact Mass | 169.96 |
| IUPAC Name | 2,3-dihydroxypropyl hypobromite |
| SMILES | OCC(O)COBr |
| InChI | InChI=1S/C3H7BrO3/c4-7-2-3(6)1-5/h3,5-6H,1-2H2 |
| InChIKey | QKLTWTXYGRNBIX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.99 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |