About CID 88654281
CID 88654281 (PubChem CID 88654281) has the molecular formula C3H7AlClO3
and a molecular weight of 153.52 g/mol.
Molecular Properties
| Compound Name | CID 88654281 |
| PubChem CID | 88654281 |
| Molecular Formula | C3H7AlClO3 |
| Molecular Weight | 153.52 g/mol |
| Exact Mass | 152.99 |
| IUPAC Name | — |
| SMILES | OCC(O)COCl.[Al] |
| InChI | InChI=1S/C3H7ClO3.Al/c4-7-2-3(6)1-5;/h3,5-6H,1-2H2; |
| InChIKey | SPRUYMLSUNKMCX-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.52 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 88654281 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88654281?
The IUPAC name of CID 88654281 (CID 88654281) is not available.
What is the SMILES notation for CID 88654281?
The canonical SMILES for CID 88654281 is OCC(O)COCl.[Al].
What is the InChIKey of CID 88654281?
The InChIKey is SPRUYMLSUNKMCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7ClO3.Al/c4-7-2-3(6)1-5;/h3,5-6H,1-2H2;.
What are the key properties of CID 88654281?
CID 88654281 has a molecular weight of 153.52 g/mol, XLogP of -0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88654281 is sourced from PubChem (CID 88654281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).