acetic acid;3-methoxypropane-1,2-diol

C6H14O5 — CID 71422269

IUPACacetic acid;3-methoxypropane-1,2-diol
SMILESCC(=O)O.COCC(O)CO
InChIInChI=1S/C4H10O3.C2H4O2/c1-7-3-4(6)2-5;1-2(3)4/h4-6H,2-3H2,1H3;1H3,(H,3,4)
InChIKeyWLGNMJPVQDHVDT-UHFFFAOYSA-N
MW166.17 g/mol
LogP-0.92
Rot. Bonds3

About acetic acid;3-methoxypropane-1,2-diol

acetic acid;3-methoxypropane-1,2-diol (PubChem CID 71422269) has the molecular formula C6H14O5 and a molecular weight of 166.17 g/mol. Its IUPAC name is acetic acid;3-methoxypropane-1,2-diol.

Molecular Properties

Compound Nameacetic acid;3-methoxypropane-1,2-diol
PubChem CID71422269
Molecular FormulaC6H14O5
Molecular Weight166.17 g/mol
Exact Mass166.08
IUPAC Nameacetic acid;3-methoxypropane-1,2-diol
SMILESCC(=O)O.COCC(O)CO
InChIInChI=1S/C4H10O3.C2H4O2/c1-7-3-4(6)2-5;1-2(3)4/h4-6H,2-3H2,1H3;1H3,(H,3,4)
InChIKeyWLGNMJPVQDHVDT-UHFFFAOYSA-N
XLogP-0.92
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.17
LogP ≤ 5-0.92
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze acetic acid;3-methoxypropane-1,2-diol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3-methoxypropane-1,2-diol?
The IUPAC name of acetic acid;3-methoxypropane-1,2-diol (CID 71422269) is acetic acid;3-methoxypropane-1,2-diol.
What is the SMILES notation for acetic acid;3-methoxypropane-1,2-diol?
The canonical SMILES for acetic acid;3-methoxypropane-1,2-diol is CC(=O)O.COCC(O)CO.
What is the InChIKey of acetic acid;3-methoxypropane-1,2-diol?
The InChIKey is WLGNMJPVQDHVDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3.C2H4O2/c1-7-3-4(6)2-5;1-2(3)4/h4-6H,2-3H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-methoxypropane-1,2-diol?
acetic acid;3-methoxypropane-1,2-diol has a molecular weight of 166.17 g/mol, XLogP of -0.92, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-methoxypropane-1,2-diol is sourced from PubChem (CID 71422269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).