C7H20O5 — CID 159796691
methane;methoxymethanol;3-methoxypropane-1,2-diol (PubChem CID 159796691) has the molecular formula C7H20O5 and a molecular weight of 184.23 g/mol. Its IUPAC name is methane;methoxymethanol;3-methoxypropane-1,2-diol.
| Compound Name | methane;methoxymethanol;3-methoxypropane-1,2-diol |
|---|---|
| PubChem CID | 159796691 |
| Molecular Formula | C7H20O5 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | methane;methoxymethanol;3-methoxypropane-1,2-diol |
| SMILES | C.COCC(O)CO.COCO |
| InChI | InChI=1S/C4H10O3.C2H6O2.CH4/c1-7-3-4(6)2-5;1-4-2-3;/h4-6H,2-3H2,1H3;3H,2H2,1H3;1H4 |
| InChIKey | NJGKUCABCTZDKE-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|