C4H10O3 — CID 164541909
(2S)-3-(trideuteriomethoxy)propane-1,2-diol (PubChem CID 164541909) has the molecular formula C4H10O3 and a molecular weight of 109.14 g/mol. Its IUPAC name is (2S)-3-(trideuteriomethoxy)propane-1,2-diol.
| Compound Name | (2S)-3-(trideuteriomethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 164541909 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 109.14 g/mol |
| Exact Mass | 109.08 |
| IUPAC Name | (2S)-3-(trideuteriomethoxy)propane-1,2-diol |
| SMILES | [2H]C([2H])([2H])OC[C@@H](O)CO |
| InChI | InChI=1S/C4H10O3/c1-7-3-4(6)2-5/h4-6H,2-3H2,1H3/t4-/m0/s1/i1D3 |
| InChIKey | PSJBSUHYCGQTHZ-OSIBIXDNSA-N |
| XLogP | -1.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.14 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |