C4H12Cl2O3 — CID 87908148
3-methoxypropane-1,2-diol;dihydrochloride (PubChem CID 87908148) has the molecular formula C4H12Cl2O3 and a molecular weight of 179.04 g/mol. Its IUPAC name is 3-methoxypropane-1,2-diol;dihydrochloride.
| Compound Name | 3-methoxypropane-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 87908148 |
| Molecular Formula | C4H12Cl2O3 |
| Molecular Weight | 179.04 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 3-methoxypropane-1,2-diol;dihydrochloride |
| SMILES | COCC(O)CO.Cl.Cl |
| InChI | InChI=1S/C4H10O3.2ClH/c1-7-3-4(6)2-5;;/h4-6H,2-3H2,1H3;2*1H |
| InChIKey | HHRWAXPGIUNOST-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.04 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |